CAS 5015-38-3 appears in our catalog under these names: Barium 2-cyanoethylphosphate hydrate, 95%, 2-Cyanoethyl Phosphate, Barium Salt Dihydrate, Barium 2-cyanoethyl phosphate, 98%, Barium 2–cyanoethyl phosphate. Offered by: Combi-blocks, TRC, AmBeed, GLPBio. Available pack sizes: 5g, 25g, 1g, 10g.
Barium(2+);2-cyanoethyl phosphate (CAS 5015-38-3) is a chemical compound with the molecular formula C3H4BaNO4P and a molecular weight of 286.37 g/mol. IUPAC name: barium(2+);2-cyanoethyl phosphate. InChIKey: MRQIDZJGQMWVQR-UHFFFAOYSA-L.
| Molecular formula | C3H4BaNO4P |
|---|---|
| Molecular weight | 286.37 g/mol |
| IUPAC name | barium(2+);2-cyanoethyl phosphate |
| InChIKey | MRQIDZJGQMWVQR-UHFFFAOYSA-L |
| SMILES | C(COP(=O)([O-])[O-])C#N.[Ba+2] |
Computed by PubChem (NCBI)