CAS 501698-03-9 appears in our catalog under these names: Gdp366, 95%, GDP366/ 99.84% (existing batch purity), GDP366, GDP366 98%, 1-(4-(4-Aminothieno[2,3-d]pyrimidin-5-yl)phenyl)-3-(m-tolyl)urea, 98%, 98%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 250mg, 100mg, 1g, 1mg, 5mg, 10mg, 25mg, 50mg.
1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)phenyl]-3-(3-methylphenyl)urea (CAS 501698-03-9) is a chemical compound with the molecular formula C20H17N5OS and a molecular weight of 375.4 g/mol. IUPAC name: 1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)phenyl]-3-(3-methylphenyl)urea. InChIKey: DZSUJUOJJJCWGG-UHFFFAOYSA-N.
| Molecular formula | C20H17N5OS |
|---|---|
| Molecular weight | 375.4 g/mol |
| IUPAC name | 1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)phenyl]-3-(3-methylphenyl)urea |
| InChIKey | DZSUJUOJJJCWGG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)NC(=O)NC2=CC=C(C=C2)C3=CSC4=NC=NC(=C34)N |
Computed by PubChem (NCBI)