CAS 501921-61-5 appears in our catalog under these names: Entasobulin, Entasobulin, 95%, Entasobulin/ 100%, 2-(1-(4-Chlorobenzyl)-1H-indol-3-yl)-2-oxo-N-(quinolin-6-yl)acetamide, 98%, 98%, Entasobulin, 98.53%. Offered by: GLPBio, Combi-blocks, TargetMol, Biosynth, Chemat. Available pack sizes: 5mg, 25mg, 10mg, 50mg, 100mg, 200mg, 1mg, 10mM (in 1ml dmso).
2-[1-[(4-chlorophenyl)methyl]indol-3-yl]-2-oxo-N-quinolin-6-ylacetamide (CAS 501921-61-5) is a chemical compound with the molecular formula C26H18ClN3O2 and a molecular weight of 439.9 g/mol. IUPAC name: 2-[1-[(4-chlorophenyl)methyl]indol-3-yl]-2-oxo-N-quinolin-6-ylacetamide. InChIKey: LJIUXAHLYIPHOK-UHFFFAOYSA-N.
| Molecular formula | C26H18ClN3O2 |
|---|---|
| Molecular weight | 439.9 g/mol |
| IUPAC name | 2-[1-[(4-chlorophenyl)methyl]indol-3-yl]-2-oxo-N-quinolin-6-ylacetamide |
| InChIKey | LJIUXAHLYIPHOK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2CC3=CC=C(C=C3)Cl)C(=O)C(=O)NC4=CC5=C(C=C4)N=CC=C5 |
Computed by PubChem (NCBI)