CAS 501935-89-3 appears in our catalog under these names: 1H-pyrazolo(3,4-d)pyrimidine-4,6(5h,7H)-dione, 3-bromo-, 95%, 3-​Bromo- 1H-​pyrazolo(3,​4-​d)​pyrimidine-​4,​6(5H,​7H)​-​dione. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-bromo-2,7-dihydropyrazolo[3,4-d]pyrimidine-4,6-dione (CAS 501935-89-3) is a chemical compound with the molecular formula C5H3BrN4O2 and a molecular weight of 231.01 g/mol. IUPAC name: 3-bromo-2,7-dihydropyrazolo[3,4-d]pyrimidine-4,6-dione. InChIKey: XUGWDYCNKQWEJL-UHFFFAOYSA-N.
| Molecular formula | C5H3BrN4O2 |
|---|---|
| Molecular weight | 231.01 g/mol |
| IUPAC name | 3-bromo-2,7-dihydropyrazolo[3,4-d]pyrimidine-4,6-dione |
| InChIKey | XUGWDYCNKQWEJL-UHFFFAOYSA-N |
| SMILES | C12=C(NN=C1NC(=O)NC2=O)Br |
Computed by PubChem (NCBI)