Products 502139-01-7
CAS 502139-01-7 is the registry number for Synucleozid. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 100mg, 5mg, 50mg, 1g, Get quote.
2-[4-(4-carbamimidoylanilino)phenyl]-1H-indole-6-carboximidamide (CAS 502139-01-7) is a chemical compound with the molecular formula C22H20N6 and a molecular weight of 368.4 g/mol. IUPAC name: 2-[4-(4-carbamimidoylanilino)phenyl]-1H-indole-6-carboximidamide. InChIKey: TZRXNWCLKYWDNH-UHFFFAOYSA-N.
| Molecular formula | C22H20N6 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | 2-[4-(4-carbamimidoylanilino)phenyl]-1H-indole-6-carboximidamide |
| InChIKey | TZRXNWCLKYWDNH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC3=C(N2)C=C(C=C3)C(=N)N)NC4=CC=C(C=C4)C(=N)N |
Computed by PubChem (NCBI)