Products 50264-75-0

CAS 50264-75-0 is the registry number for 1-(2,4-DIBROMOBENZYL)-1H-INDAZOLE-3-CARBOXYLIC ACID, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

1-[(2,4-dibromophenyl)methyl]indazole-3-carboxylic acid (CAS 50264-75-0) is a chemical compound with the molecular formula C15H10Br2N2O2 and a molecular weight of 410.06 g/mol. IUPAC name: 1-[(2,4-dibromophenyl)methyl]indazole-3-carboxylic acid. InChIKey: DYMCJIUYDSLBSD-UHFFFAOYSA-N.

Identity
Molecular formulaC15H10Br2N2O2
Molecular weight410.06 g/mol
IUPAC name1-[(2,4-dibromophenyl)methyl]indazole-3-carboxylic acid
InChIKeyDYMCJIUYDSLBSD-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=NN2CC3=C(C=C(C=C3)Br)Br)C(=O)O

Computed by PubChem (NCBI)