CAS 502650-56-8 is the registry number for Methyl cis-3-hydroxymethylcyclohexane-1-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
Cis-methyl (1S,3R)-3-(hydroxymethyl)cyclohexane-1-carboxylate (CAS 502650-56-8) is a chemical compound with the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. IUPAC name: cis-methyl (1S,3R)-3-(hydroxymethyl)cyclohexane-1-carboxylate. InChIKey: JNCPTEDQFZOIHX-SFYZADRCSA-N.
| Molecular formula | C9H16O3 |
|---|---|
| Molecular weight | 172.22 g/mol |
| IUPAC name | cis-methyl (1S,3R)-3-(hydroxymethyl)cyclohexane-1-carboxylate |
| InChIKey | JNCPTEDQFZOIHX-SFYZADRCSA-N |
| SMILES | COC(=O)[C@H]1CCC[C@H](C1)CO |
Computed by PubChem (NCBI)