CAS 502650-66-0 is the registry number for Methyl trans-2-hydroxymethylcyclopentane-1-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Cis-methyl (1R,2R)-2-(hydroxymethyl)cyclopentane-1-carboxylate (CAS 502650-66-0) is a chemical compound with the molecular formula C8H14O3 and a molecular weight of 158.19 g/mol. IUPAC name: cis-methyl (1R,2R)-2-(hydroxymethyl)cyclopentane-1-carboxylate. InChIKey: IHJMUKVEQZAEKV-NKWVEPMBSA-N.
| Molecular formula | C8H14O3 |
|---|---|
| Molecular weight | 158.19 g/mol |
| IUPAC name | cis-methyl (1R,2R)-2-(hydroxymethyl)cyclopentane-1-carboxylate |
| InChIKey | IHJMUKVEQZAEKV-NKWVEPMBSA-N |
| SMILES | COC(=O)[C@@H]1CCC[C@H]1CO |
Computed by PubChem (NCBI)