Products 50293-91-9
CAS 50293-91-9 appears in our catalog under these names: (S)-Salbutamol Hydrochloride, Salbutamol Impurity 15（Salbutamol (S)-Isomer HCl）, (S)-Albuterol Hydrochloride, (S)-Albuterol (hydrochloride). Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 2mg.
4-[(1S)-2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenol;hydrochloride (CAS 50293-91-9) is a chemical compound with the molecular formula C13H22ClNO3 and a molecular weight of 275.77 g/mol. IUPAC name: 4-[(1S)-2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenol;hydrochloride. InChIKey: OWNWYCOLFIFTLK-UTONKHPSSA-N.
| Molecular formula | C13H22ClNO3 |
|---|---|
| Molecular weight | 275.77 g/mol |
| IUPAC name | 4-[(1S)-2-(tert-butylamino)-1-hydroxyethyl]-2-(hydroxymethyl)phenol;hydrochloride |
| InChIKey | OWNWYCOLFIFTLK-UTONKHPSSA-N |
| SMILES | CC(C)(C)NC[C@H](C1=CC(=C(C=C1)O)CO)O.Cl |
Computed by PubChem (NCBI)