CAS 50296-37-2 appears in our catalog under these names: Bromotris(dimethylamino)phosphonium Hexafluorophosphate, Bromotris(dimethylamino)phosphonium Hexafluorophosphate, >98.0%(HPLC)(T), BroP 98%, Bromotris(dimethylamino)phosphoniumhexafluorophosphate, 97%. Offered by: GLPBio, TCI, Ambeed, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1g, 10g, 500g.
Bromo-tris(dimethylamino)phosphanium hexafluorophosphate (CAS 50296-37-2) is a chemical compound with the molecular formula C6H18BrF6N3P2 and a molecular weight of 388.07 g/mol. IUPAC name: bromo-tris(dimethylamino)phosphanium hexafluorophosphate. InChIKey: XELPBWPBGHCIKX-UHFFFAOYSA-N.
| Molecular formula | C6H18BrF6N3P2 |
|---|---|
| Molecular weight | 388.07 g/mol |
| IUPAC name | bromo-tris(dimethylamino)phosphanium hexafluorophosphate |
| InChIKey | XELPBWPBGHCIKX-UHFFFAOYSA-N |
| SMILES | CN(C)[P+](N(C)C)(N(C)C)Br.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)