CAS 50299-42-8 appears in our catalog under these names: 3,5-Dibromo-D-tyrosine, 95%, 3,5–Dibromo–D–tyrosine, (R)-2-Amino-3-(3,5-dibromo-4-hydroxyphenyl)propanoic acid, 98%, 98%, 3,5-Dibromo-D-tyrosine, 99.80%, (R)-2-Amino-3-(3,5-dibromo-4-hydroxyphenyl)propanoic acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 25g, 1g, 5g, 10g, 100mg, 250mg, 10 g, 1 g.
(2R)-2-amino-3-(3,5-dibromo-4-hydroxyphenyl)propanoic acid (CAS 50299-42-8) is a chemical compound with the molecular formula C9H9Br2NO3 and a molecular weight of 338.98 g/mol. IUPAC name: (2R)-2-amino-3-(3,5-dibromo-4-hydroxyphenyl)propanoic acid. InChIKey: COESHZUDRKCEPA-SSDOTTSWSA-N.
| Molecular formula | C9H9Br2NO3 |
|---|---|
| Molecular weight | 338.98 g/mol |
| IUPAC name | (2R)-2-amino-3-(3,5-dibromo-4-hydroxyphenyl)propanoic acid |
| InChIKey | COESHZUDRKCEPA-SSDOTTSWSA-N |
| SMILES | C1=C(C=C(C(=C1Br)O)Br)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)