CAS 50301-19-4 is the registry number for 3,5-Dinitrophenyl beta-D-Galactoside. Offered by: TRC. Available pack sizes: 250mg.
(2S,3R,4S,5R,6R)-2-(3,5-dinitrophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (CAS 50301-19-4) is a chemical compound with the molecular formula C12H14N2O10 and a molecular weight of 346.25 g/mol. IUPAC name: (2S,3R,4S,5R,6R)-2-(3,5-dinitrophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: VNPOTVPDCPRUPK-YBXAARCKSA-N.
| Molecular formula | C12H14N2O10 |
|---|---|
| Molecular weight | 346.25 g/mol |
| IUPAC name | (2S,3R,4S,5R,6R)-2-(3,5-dinitrophenoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | VNPOTVPDCPRUPK-YBXAARCKSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])O[C@H]2[C@@H]([C@H]([C@H]([C@H](O2)CO)O)O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)