CAS 503064-95-7 is the registry number for Sildenafil Impurity 81. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-1-methyl-3-propan-2-ylpyrazole-5-carboxamide (CAS 503064-95-7) is a chemical compound with the molecular formula C8H14N4O and a molecular weight of 182.22 g/mol. IUPAC name: 4-amino-1-methyl-3-propan-2-ylpyrazole-5-carboxamide. InChIKey: HJSSWAAHKTXNLX-UHFFFAOYSA-N.
| Molecular formula | C8H14N4O |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 4-amino-1-methyl-3-propan-2-ylpyrazole-5-carboxamide |
| InChIKey | HJSSWAAHKTXNLX-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NN(C(=C1N)C(=O)N)C |
Computed by PubChem (NCBI)