Products 503068-31-3

CAS 503068-31-3 is the registry number for Vilanterol Impurity 14. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

2-(6-bromohexoxy)ethoxymethylbenzene (CAS 503068-31-3) is a chemical compound with the molecular formula C15H23BrO2 and a molecular weight of 315.25 g/mol. IUPAC name: 2-(6-bromohexoxy)ethoxymethylbenzene. InChIKey: WBNXVRIVOMSBLK-UHFFFAOYSA-N.

Identity
Molecular formulaC15H23BrO2
Molecular weight315.25 g/mol
IUPAC name2-(6-bromohexoxy)ethoxymethylbenzene
InChIKeyWBNXVRIVOMSBLK-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COCCOCCCCCCBr

Computed by PubChem (NCBI)