Products 5032-93-9

CAS 5032-93-9 is the registry number for Bis(pentafluorophenyl)hydroxyphosphine, 96%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

Bis(2,3,4,5,6-pentafluorophenyl)phosphinous acid (CAS 5032-93-9) is a chemical compound with the molecular formula C12HF10OP and a molecular weight of 382.09 g/mol. IUPAC name: bis(2,3,4,5,6-pentafluorophenyl)phosphinous acid. InChIKey: XFRBKSOIRNHMSA-UHFFFAOYSA-N.

Identity
Molecular formulaC12HF10OP
Molecular weight382.09 g/mol
IUPAC namebis(2,3,4,5,6-pentafluorophenyl)phosphinous acid
InChIKeyXFRBKSOIRNHMSA-UHFFFAOYSA-N
SMILESC1(=C(C(=C(C(=C1F)F)P(C2=C(C(=C(C(=C2F)F)F)F)F)O)F)F)F

Computed by PubChem (NCBI)