CAS 5032-93-9 is the registry number for Bis(pentafluorophenyl)hydroxyphosphine, 96%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
Bis(2,3,4,5,6-pentafluorophenyl)phosphinous acid (CAS 5032-93-9) is a chemical compound with the molecular formula C12HF10OP and a molecular weight of 382.09 g/mol. IUPAC name: bis(2,3,4,5,6-pentafluorophenyl)phosphinous acid. InChIKey: XFRBKSOIRNHMSA-UHFFFAOYSA-N.
| Molecular formula | C12HF10OP |
|---|---|
| Molecular weight | 382.09 g/mol |
| IUPAC name | bis(2,3,4,5,6-pentafluorophenyl)phosphinous acid |
| InChIKey | XFRBKSOIRNHMSA-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)F)P(C2=C(C(=C(C(=C2F)F)F)F)F)O)F)F)F |
Computed by PubChem (NCBI)