CAS 503470-23-3 appears in our catalog under these names: 4-Formyl-2-methylbenzoic acid, 95%, Fluralaner Impurity 9, 4-Formyl-2-methylbenzoic acid 98%, 4-Formyl-2-methylbenzoic acid, 97%, 97%, 4-Formyl-2-methylbenzoic acid, 97%. Offered by: Combi-blocks, Chemat Brand, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, on request, 250mg, 5g.
4-formyl-2-methylbenzoic acid (CAS 503470-23-3) is a chemical compound with the molecular formula C9H8O3 and a molecular weight of 164.16 g/mol. IUPAC name: 4-formyl-2-methylbenzoic acid. InChIKey: OIWOOOJFKXTXKV-UHFFFAOYSA-N.
| Molecular formula | C9H8O3 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | 4-formyl-2-methylbenzoic acid |
| InChIKey | OIWOOOJFKXTXKV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C=O)C(=O)O |
Computed by PubChem (NCBI)