Products 50348-93-1
CAS 50348-93-1 appears in our catalog under these names: 2-Methylalanine-d6, >95% (HPLC), 2-Amino-iso-butyric-d6 Acid (dimethyl-d6), 99 atom % D, min 98% Chemical Purity, 2-Amino-2-(2H3)methyl(2H3)propanoic acid, NSC 16590-d6, 99.72%. Offered by: TRC, CDN, Biosynth, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 0,1g, 0,05g, 100g, 10 mg, 5 mg, 50 mg.
2-amino-3,3,3-trideuterio-2-(trideuteriomethyl)propanoic acid (CAS 50348-93-1) is a chemical compound with the molecular formula C4H9NO2 and a molecular weight of 109.16 g/mol. IUPAC name: 2-amino-3,3,3-trideuterio-2-(trideuteriomethyl)propanoic acid. InChIKey: FUOOLUPWFVMBKG-WFGJKAKNSA-N.
| Molecular formula | C4H9NO2 |
|---|---|
| Molecular weight | 109.16 g/mol |
| IUPAC name | 2-amino-3,3,3-trideuterio-2-(trideuteriomethyl)propanoic acid |
| InChIKey | FUOOLUPWFVMBKG-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C(C(=O)O)(C([2H])([2H])[2H])N |
Computed by PubChem (NCBI)