CAS 50358-62-8 appears in our catalog under these names: 8–Chloroquinolin–6–amine, 8-Chloroquinolin-6-amine, 95%, 8-Chloroquinolin-6-amine 97%, 8-Chloroquinolin-6-amine, 97%, 8-Chloroquinolin-6-amine, 97%, 97%. Offered by: GLPBio, Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
8-chloroquinolin-6-amine (CAS 50358-62-8) is a chemical compound with the molecular formula C9H7ClN2 and a molecular weight of 178.62 g/mol. IUPAC name: 8-chloroquinolin-6-amine. InChIKey: RCACJWHTFMNNFC-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2 |
|---|---|
| Molecular weight | 178.62 g/mol |
| IUPAC name | 8-chloroquinolin-6-amine |
| InChIKey | RCACJWHTFMNNFC-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CC(=C2N=C1)Cl)N |
Computed by PubChem (NCBI)