CAS 50372-61-7 appears in our catalog under these names: 2,3-Dibromo-5-Benzoylpyrrole, 4,5-Dibromo-2-benzoylpyrrole. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
(4,5-dibromo-1H-pyrrol-2-yl)-phenylmethanone (CAS 50372-61-7) is a chemical compound with the molecular formula C11H7Br2NO and a molecular weight of 328.99 g/mol. IUPAC name: (4,5-dibromo-1H-pyrrol-2-yl)-phenylmethanone. InChIKey: ZTJSJDHXCJVYCI-UHFFFAOYSA-N.
| Molecular formula | C11H7Br2NO |
|---|---|
| Molecular weight | 328.99 g/mol |
| IUPAC name | (4,5-dibromo-1H-pyrrol-2-yl)-phenylmethanone |
| InChIKey | ZTJSJDHXCJVYCI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=C(N2)Br)Br |
Computed by PubChem (NCBI)