Products 503844-09-5
CAS 503844-09-5 appears in our catalog under these names: EA–230, EA-230, 99.92%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, 10mg, 10 mg, 5 mg.
(2S)-2-[[2-[[(2S)-5-amino-2-[[(2S)-2-aminopropanoyl]amino]-5-oxopentanoyl]amino]acetyl]amino]-3-methylbutanoic acid (CAS 503844-09-5) is a chemical compound with the molecular formula C15H27N5O6 and a molecular weight of 373.40 g/mol. IUPAC name: (2S)-2-[[2-[[(2S)-5-amino-2-[[(2S)-2-aminopropanoyl]amino]-5-oxopentanoyl]amino]acetyl]amino]-3-methylbutanoic acid. InChIKey: DXRXYJYFADHAPA-AUTRQRHGSA-N.
| Molecular formula | C15H27N5O6 |
|---|---|
| Molecular weight | 373.40 g/mol |
| IUPAC name | (2S)-2-[[2-[[(2S)-5-amino-2-[[(2S)-2-aminopropanoyl]amino]-5-oxopentanoyl]amino]acetyl]amino]-3-methylbutanoic acid |
| InChIKey | DXRXYJYFADHAPA-AUTRQRHGSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](CCC(=O)N)C(=O)NCC(=O)N[C@@H](C(C)C)C(=O)O)N |
Computed by PubChem (NCBI)