CAS 503862-08-6 is the registry number for 4,7-Bis(4-methoxyphenyl)benzo[c][1,2,5]thiadiazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4,7-bis(4-methoxyphenyl)-2,1,3-benzothiadiazole (CAS 503862-08-6) is a chemical compound with the molecular formula C20H16N2O2S and a molecular weight of 348.4 g/mol. IUPAC name: 4,7-bis(4-methoxyphenyl)-2,1,3-benzothiadiazole. InChIKey: RVIBWUAMGUFQMT-UHFFFAOYSA-N.
| Molecular formula | C20H16N2O2S |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | 4,7-bis(4-methoxyphenyl)-2,1,3-benzothiadiazole |
| InChIKey | RVIBWUAMGUFQMT-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC=C(C3=NSN=C23)C4=CC=C(C=C4)OC |
Computed by PubChem (NCBI)