CAS 5044-52-0 appears in our catalog under these names: Vinyltriphenylphosphonium bromide, 97%, Vinyltriphenylphosphonium bromide, Vinyltriphenylphosphonium bromide, 97% , Triphenylvinylphosphonium Bromide, Triphenyl(vinyl)phosphonium Bromide, >96.0%(HPLC)(T). Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 1g, 10g, 25g, 100g, 5g.
Ethenyl(triphenyl)phosphanium bromide (CAS 5044-52-0) is a chemical compound with the molecular formula C20H18BrP and a molecular weight of 369.2 g/mol. IUPAC name: ethenyl(triphenyl)phosphanium bromide. InChIKey: VRAYVWUMBAJVGH-UHFFFAOYSA-M.
| Molecular formula | C20H18BrP |
|---|---|
| Molecular weight | 369.2 g/mol |
| IUPAC name | ethenyl(triphenyl)phosphanium bromide |
| InChIKey | VRAYVWUMBAJVGH-UHFFFAOYSA-M |
| SMILES | C=C[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)