CAS 50540-16-4 is the registry number for 2-((7-Nitro-2,1,3-benzoxadiazol-4-yl)amino)ethanethiol. Offered by: TRC. Available pack sizes: 250mg.
2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]ethanethiol (CAS 50540-16-4) is a chemical compound with the molecular formula C8H8N4O3S and a molecular weight of 240.24 g/mol. IUPAC name: 2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]ethanethiol. InChIKey: GTMXMYOAJNPZPR-UHFFFAOYSA-N.
| Molecular formula | C8H8N4O3S |
|---|---|
| Molecular weight | 240.24 g/mol |
| IUPAC name | 2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]ethanethiol |
| InChIKey | GTMXMYOAJNPZPR-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NON=C2C(=C1)[N+](=O)[O-])NCCS |
Computed by PubChem (NCBI)