CAS 5055-20-9 is the registry number for Nifurquinazole. Offered by: TRC. Available pack sizes: 250mg.
2-[2-hydroxyethyl-[2-(5-nitrofuran-2-yl)quinazolin-4-yl]amino]ethanol (CAS 5055-20-9) is a chemical compound with the molecular formula C16H16N4O5 and a molecular weight of 344.32 g/mol. IUPAC name: 2-[2-hydroxyethyl-[2-(5-nitrofuran-2-yl)quinazolin-4-yl]amino]ethanol. InChIKey: AUEOHSUMWXAPBX-UHFFFAOYSA-N.
| Molecular formula | C16H16N4O5 |
|---|---|
| Molecular weight | 344.32 g/mol |
| IUPAC name | 2-[2-hydroxyethyl-[2-(5-nitrofuran-2-yl)quinazolin-4-yl]amino]ethanol |
| InChIKey | AUEOHSUMWXAPBX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NC(=N2)C3=CC=C(O3)[N+](=O)[O-])N(CCO)CCO |
Computed by PubChem (NCBI)