CAS 50571-15-8 appears in our catalog under these names: M-Carborane-1,7-dicarboxylic acid, 95%, m-Carborane-1,7-dicarboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 250mg, 1000mg, 500mg.
CAS 50571-15-8 identifies a chemical compound with the molecular formula C4H2B10O4 and a molecular weight of 222.2 g/mol. InChIKey: NSOPHJXKTXXICF-UHFFFAOYSA-N.
| Molecular formula | C4H2B10O4 |
|---|---|
| Molecular weight | 222.2 g/mol |
| InChIKey | NSOPHJXKTXXICF-UHFFFAOYSA-N |
| SMILES | [B]1[B][B][B][B]C2([B]C([B]2)([B][B][B]1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)