Products 50580-23-9
CAS 50580-23-9 is the registry number for ST166 (free acid). Offered by: MedChemExpress. Available pack sizes: Get quote.
[8-(sulfomethyl)-1,2,5,6-tetrathiocan-3-yl]methanesulfonic acid (CAS 50580-23-9) is a chemical compound with the molecular formula C6H12O6S6 and a molecular weight of 372.6 g/mol. IUPAC name: [8-(sulfomethyl)-1,2,5,6-tetrathiocan-3-yl]methanesulfonic acid. InChIKey: CBHYORIGHCURGO-UHFFFAOYSA-N.
| Molecular formula | C6H12O6S6 |
|---|---|
| Molecular weight | 372.6 g/mol |
| IUPAC name | [8-(sulfomethyl)-1,2,5,6-tetrathiocan-3-yl]methanesulfonic acid |
| InChIKey | CBHYORIGHCURGO-UHFFFAOYSA-N |
| SMILES | C1C(SSC(CSS1)CS(=O)(=O)O)CS(=O)(=O)O |
Computed by PubChem (NCBI)