CAS 50585-29-0 appears in our catalog under these names: 1,8-Bis(chloromethyl)naphthalene, 1,8-Bis(chloromethyl)naphthalene 97%. Offered by: TRC, Ambeed. Available pack sizes: 5g, 100mg, 250mg, 1g.
1,8-bis(chloromethyl)naphthalene (CAS 50585-29-0) is a chemical compound with the molecular formula C12H10Cl2 and a molecular weight of 225.11 g/mol. IUPAC name: 1,8-bis(chloromethyl)naphthalene. InChIKey: RBOMVULADCTBLK-UHFFFAOYSA-N.
| Molecular formula | C12H10Cl2 |
|---|---|
| Molecular weight | 225.11 g/mol |
| IUPAC name | 1,8-bis(chloromethyl)naphthalene |
| InChIKey | RBOMVULADCTBLK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)CCl)C(=CC=C2)CCl |
Computed by PubChem (NCBI)