CAS 5059-58-5 is the registry number for NSC 116339. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 1mg, 5mg, 10mg, 25mg.
CAS 5059-58-5 identifies a chemical compound with the molecular formula C26H34O7 and a molecular weight of 458.5 g/mol. InChIKey: WKLPTHVGGWUGJV-YBEGLDIGSA-N.
| Molecular formula | C26H34O7 |
|---|---|
| Molecular weight | 458.5 g/mol |
| InChIKey | WKLPTHVGGWUGJV-YBEGLDIGSA-N |
| SMILES | CC1CC2C3C=C(C4=CC(=O)/C(=C\O)/CC4(C3C(CC2(C15C6(COCO6)OCO5)C)O)C)C |
Computed by PubChem (NCBI)