CAS 506-93-4 appears in our catalog under these names: Guanidine Nitrate, Guanidine nitrate, 98% , Guanidine Nitrate, >98.0%(T), GUANIDINE NITRATE, 98%. Offered by: TRC, Thermo Scientific (Alfa Aesar), Biosynth, TCI, Sigma-Aldrich. Available pack sizes: 100g, 10g, 250g, 1000g, 500g, 25g, 2000g, 1KG.
Guanidine;nitric acid (CAS 506-93-4) is a chemical compound with the molecular formula CH6N4O3 and a molecular weight of 122.08 g/mol. IUPAC name: guanidine;nitric acid. InChIKey: CNUNWZZSUJPAHX-UHFFFAOYSA-N.
| Molecular formula | CH6N4O3 |
|---|---|
| Molecular weight | 122.08 g/mol |
| IUPAC name | guanidine;nitric acid |
| InChIKey | CNUNWZZSUJPAHX-UHFFFAOYSA-N |
| SMILES | C(=N)(N)N.[N+](=O)(O)[O-] |
Computed by PubChem (NCBI)