CAS 5060-82-2 appears in our catalog under these names: 7-Methoxy-2-naphthol, 7–Methoxy–2–naphthol, 7-Methoxy-2-naphthol, 97%, 7-Methoxynaphthalen-2-ol 97%, 7-METHOXY-2-NAPHTHOL, 98%. Offered by: TRC, GLPBio, Thermo Scientific (Acros), Ambeed, Sigma-Aldrich. Available pack sizes: 1g, 250mg, 25g, 5g, 10g, 100g, 500g.
7-methoxynaphthalen-2-ol (CAS 5060-82-2) is a chemical compound with the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. IUPAC name: 7-methoxynaphthalen-2-ol. InChIKey: UNFNRIIETORURP-UHFFFAOYSA-N.
| Molecular formula | C11H10O2 |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 7-methoxynaphthalen-2-ol |
| InChIKey | UNFNRIIETORURP-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=CC(=C2)O)C=C1 |
Computed by PubChem (NCBI)