Products 506417-09-0
CAS 506417-09-0 appears in our catalog under these names: GPR41 agonist-1, GPR41 agonist–1, GPR41 agonist-1, 98.04%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 2mg, 10mg, 100mg, 25mg, 5mg, 50mg, 25 mg, 100 mg.
2-methyl-N-(2-methylphenyl)-4-(3-nitrophenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide (CAS 506417-09-0) is a chemical compound with the molecular formula C24H23N3O4 and a molecular weight of 417.5 g/mol. IUPAC name: 2-methyl-N-(2-methylphenyl)-4-(3-nitrophenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide. InChIKey: UWQXWOJVNASZLI-UHFFFAOYSA-N.
| Molecular formula | C24H23N3O4 |
|---|---|
| Molecular weight | 417.5 g/mol |
| IUPAC name | 2-methyl-N-(2-methylphenyl)-4-(3-nitrophenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide |
| InChIKey | UWQXWOJVNASZLI-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1NC(=O)C2=C(NC3=C(C2C4=CC(=CC=C4)[N+](=O)[O-])C(=O)CCC3)C |
Computed by PubChem (NCBI)