Products 50649-56-4
CAS 50649-56-4 appears in our catalog under these names: 4-Pentylphenyl 4-octyloxybenzoate, 97%, 4–Pentylphenyl 4–(octyloxy)benzoate, 4-Pentylphenyl 4-(octyloxy)benzoate, 98%, 4-Pentylphenyl 4-(octyloxy)benzoate, 97%, 4-Pentylphenyl 4-(octyloxy)benzoate, 97%, 97%. Offered by: Combi-blocks, GLPBio, Fluorochem, Ambeed, Chemat. Available pack sizes: 1g, 5g, 25g.
(4-pentylphenyl) 4-octoxybenzoate (CAS 50649-56-4) is a chemical compound with the molecular formula C26H36O3 and a molecular weight of 396.6 g/mol. IUPAC name: (4-pentylphenyl) 4-octoxybenzoate. InChIKey: BDTRDPSFINNZRW-UHFFFAOYSA-N.
| Molecular formula | C26H36O3 |
|---|---|
| Molecular weight | 396.6 g/mol |
| IUPAC name | (4-pentylphenyl) 4-octoxybenzoate |
| InChIKey | BDTRDPSFINNZRW-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOC1=CC=C(C=C1)C(=O)OC2=CC=C(C=C2)CCCCC |
Computed by PubChem (NCBI)
Synonyms:
4-Pentylphenyl 4-(octyloxy)benzoate, pentylphenyl octyloxybenzoate, 4-Pentylphenyl 4-octyloxybenzoate, P-PENTYLPHENYL P-OCTYLOXYBENZOATE, Benzoic acid, 4-(octyloxy)-, 4-pentylphenyl ester, PENTYLPHENYL OCTYLOXYBENZOATE [INCI], (4-pentylphenyl) 4-octoxybenzoate, 4-Pentylphenyl 4-octyloxybenzoate,97, 4-Octyloxybenzoic acid 4-pentylphenyl ester, BDTRDPSFINNZRW-UHFFFAOYSA-N