CAS 50651-64-4 is the registry number for 2′-F-UDP. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate (CAS 50651-64-4) is a chemical compound with the molecular formula C9H13FN2O11P2 and a molecular weight of 406.15 g/mol. IUPAC name: [(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate. InChIKey: GPPKODXOVXLGIG-XVFCMESISA-N.
| Molecular formula | C9H13FN2O11P2 |
|---|---|
| Molecular weight | 406.15 g/mol |
| IUPAC name | [(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
| InChIKey | GPPKODXOVXLGIG-XVFCMESISA-N |
| SMILES | C1=CN(C(=O)NC1=O)[C@H]2[C@@H]([C@@H]([C@H](O2)COP(=O)(O)OP(=O)(O)O)O)F |
Computed by PubChem (NCBI)