CAS 50662-99-2 appears in our catalog under these names: Reactive Yellow 2, Cibacron Brilliant Yellow 3G-P, Technical Grade, Cibacron Brilliant Yellow 3G–P, CIBACRON BRILLIANT YELLOW 3GP. Offered by: Chemat, TRC, GLPBio, Sigma-Aldrich. Available pack sizes: 1g, 5g, 25g, 2,5g.
CAS 50662-99-2 identifies a chemical compound with the molecular formula C25H18Cl3N9NaO10S3 and a molecular weight of 830.0 g/mol. InChIKey: HTQRDEZLVAPTGL-UHFFFAOYSA-N.
| Molecular formula | C25H18Cl3N9NaO10S3 |
|---|---|
| Molecular weight | 830.0 g/mol |
| InChIKey | HTQRDEZLVAPTGL-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=O)C1N=NC2=C(C=CC(=C2)NC3=NC(=NC(=N3)NC4=CC=C(C=C4)S(=O)(=O)O)Cl)S(=O)(=O)O)C5=CC(=C(C=C5Cl)S(=O)(=O)O)Cl.[Na] |
Computed by PubChem (NCBI)