CAS 507-68-6 appears in our catalog under these names: Hexafluoroglutaramide, 95%, 2,2,3,3,4,4-Hexafluoropentanediamide, 97%, Hexafluoroglutaramide, ≥97%, ≥97%, Hexafluoroglutaramide, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 10g.
2,2,3,3,4,4-hexafluoropentanediamide (CAS 507-68-6) is a chemical compound with the molecular formula C5H4F6N2O2 and a molecular weight of 238.09 g/mol. IUPAC name: 2,2,3,3,4,4-hexafluoropentanediamide. InChIKey: WBOGURVAQVCKGX-UHFFFAOYSA-N.
| Molecular formula | C5H4F6N2O2 |
|---|---|
| Molecular weight | 238.09 g/mol |
| IUPAC name | 2,2,3,3,4,4-hexafluoropentanediamide |
| InChIKey | WBOGURVAQVCKGX-UHFFFAOYSA-N |
| SMILES | C(=O)(C(C(C(C(=O)N)(F)F)(F)F)(F)F)N |
Computed by PubChem (NCBI)