CAS 50703-46-3 is the registry number for rac-(2R,3S)-2,3-Bis(chloromethyl)oxirane. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2S,3R)-2,3-bis(chloromethyl)oxirane (CAS 50703-46-3) is a chemical compound with the molecular formula C4H6Cl2O and a molecular weight of 140.99 g/mol. IUPAC name: (2S,3R)-2,3-bis(chloromethyl)oxirane. InChIKey: VUSYFNXNYLAECV-ZXZARUISSA-N.
| Molecular formula | C4H6Cl2O |
|---|---|
| Molecular weight | 140.99 g/mol |
| IUPAC name | (2S,3R)-2,3-bis(chloromethyl)oxirane |
| InChIKey | VUSYFNXNYLAECV-ZXZARUISSA-N |
| SMILES | C([C@@H]1[C@@H](O1)CCl)Cl |
Computed by PubChem (NCBI)