CAS 50715-50-9 appears in our catalog under these names: Boc–Asp(OtBu)–OSu, Boc-Asp(OtBu)-OSu 98%, Boc-Asp(OtBu)-OSu, 95%, 95%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 25g, 5g, 250mg, 10g.
4-O-tert-butyl 1-O-(2,5-dioxopyrrolidin-1-yl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate (CAS 50715-50-9) is a chemical compound with the molecular formula C17H26N2O8 and a molecular weight of 386.4 g/mol. IUPAC name: 4-O-tert-butyl 1-O-(2,5-dioxopyrrolidin-1-yl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate. InChIKey: PIITZDSTZQZNQH-JTQLQIEISA-N.
| Molecular formula | C17H26N2O8 |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | 4-O-tert-butyl 1-O-(2,5-dioxopyrrolidin-1-yl) (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
| InChIKey | PIITZDSTZQZNQH-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)C[C@@H](C(=O)ON1C(=O)CCC1=O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)