CAS 5072-45-7 appears in our catalog under these names: 2,6-Dimethylpiperidine hydrochloride, 98+%, 2,6-dimethylpiperidine hydrochloride, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g.
(2R,6S)-2,6-dimethylpiperidine;hydrochloride (CAS 5072-45-7) is a chemical compound with the molecular formula C7H16ClN and a molecular weight of 149.66 g/mol. IUPAC name: (2R,6S)-2,6-dimethylpiperidine;hydrochloride. InChIKey: PEDXCVQZZVVOGO-UKMDXRBESA-N.
| Molecular formula | C7H16ClN |
|---|---|
| Molecular weight | 149.66 g/mol |
| IUPAC name | (2R,6S)-2,6-dimethylpiperidine;hydrochloride |
| InChIKey | PEDXCVQZZVVOGO-UKMDXRBESA-N |
| SMILES | C[C@@H]1CCC[C@@H](N1)C.Cl |
Computed by PubChem (NCBI)