CAS 507233-13-8 appears in our catalog under these names: 3-(5-Bromo-2-difluoromethoxy-phenyl)-acrylic acid, 95%, (2E)-3-(5-Bromo-2-(difluoromethoxy)phenyl)prop-2-enoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 0,5g, 50mg.
(E)-3-[5-bromo-2-(difluoromethoxy)phenyl]prop-2-enoic acid (CAS 507233-13-8) is a chemical compound with the molecular formula C10H7BrF2O3 and a molecular weight of 293.06 g/mol. IUPAC name: (E)-3-[5-bromo-2-(difluoromethoxy)phenyl]prop-2-enoic acid. InChIKey: ZTDTZLBJFJSGHB-DAFODLJHSA-N.
| Molecular formula | C10H7BrF2O3 |
|---|---|
| Molecular weight | 293.06 g/mol |
| IUPAC name | (E)-3-[5-bromo-2-(difluoromethoxy)phenyl]prop-2-enoic acid |
| InChIKey | ZTDTZLBJFJSGHB-DAFODLJHSA-N |
| SMILES | C1=CC(=C(C=C1Br)/C=C/C(=O)O)OC(F)F |
Computed by PubChem (NCBI)