CAS 50767-71-0 appears in our catalog under these names: (3R,4S,5S,6S)-2-Hydroxy-6-(methoxycarbonyl)tetrahydro-2H-pyran-3,4,5-triyl tribenzoate, 98%, 2,3,4-Tri-O-benzoyl-5-hydroxy-D-glucuronic Acid Methyl Ester, 2,3,4-Tri-O-benzoyl-D-glucuronide methyl ester, D-Glucuronic acid,methyl ester,2,3,4-tribenzoate. Offered by: Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 100mg, 200mg, 50mg, 500mg, 1000mg, 200 mg, 25 mg.
Methyl (2S,3S,4S,5R)-3,4,5-tribenzoyloxy-6-hydroxyoxane-2-carboxylate (CAS 50767-71-0) is a chemical compound with the molecular formula C28H24O10 and a molecular weight of 520.5 g/mol. IUPAC name: methyl (2S,3S,4S,5R)-3,4,5-tribenzoyloxy-6-hydroxyoxane-2-carboxylate. InChIKey: QGJKDUIQLRJYBH-LYKLCEDHSA-N.
| Molecular formula | C28H24O10 |
|---|---|
| Molecular weight | 520.5 g/mol |
| IUPAC name | methyl (2S,3S,4S,5R)-3,4,5-tribenzoyloxy-6-hydroxyoxane-2-carboxylate |
| InChIKey | QGJKDUIQLRJYBH-LYKLCEDHSA-N |
| SMILES | COC(=O)[C@@H]1[C@H]([C@@H]([C@H](C(O1)O)OC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)