CAS 50768-75-7 appears in our catalog under these names: 1,3–Diamino–4–(5–bromo–2–pyridylazo)benzene, 4-((5-Bromopyridin-2-yl)diazenyl)benzene-1,3-diamine, 97%, 97%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 25g, 500mg, 5g, 250mg, 10g.
4-[(5-bromo-2-pyridinyl)diazenyl]benzene-1,3-diamine (CAS 50768-75-7) is a chemical compound with the molecular formula C11H10BrN5 and a molecular weight of 292.13 g/mol. IUPAC name: 4-[(5-bromo-2-pyridinyl)diazenyl]benzene-1,3-diamine. InChIKey: XHJGETUGTPYUKU-UHFFFAOYSA-N.
| Molecular formula | C11H10BrN5 |
|---|---|
| Molecular weight | 292.13 g/mol |
| IUPAC name | 4-[(5-bromo-2-pyridinyl)diazenyl]benzene-1,3-diamine |
| InChIKey | XHJGETUGTPYUKU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)N)N=NC2=NC=C(C=C2)Br |
Computed by PubChem (NCBI)