Products 50790-71-1

CAS 50790-71-1 is the registry number for Methyl 5-hydroxy-2,4-dimethylbenzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 5-hydroxy-2,4-dimethylbenzoate (CAS 50790-71-1) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: methyl 5-hydroxy-2,4-dimethylbenzoate. InChIKey: UULOJLNDMUKVNI-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12O3
Molecular weight180.20 g/mol
IUPAC namemethyl 5-hydroxy-2,4-dimethylbenzoate
InChIKeyUULOJLNDMUKVNI-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1C(=O)OC)O)C

Computed by PubChem (NCBI)