CAS 50790-71-1 is the registry number for Methyl 5-hydroxy-2,4-dimethylbenzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-hydroxy-2,4-dimethylbenzoate (CAS 50790-71-1) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: methyl 5-hydroxy-2,4-dimethylbenzoate. InChIKey: UULOJLNDMUKVNI-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | methyl 5-hydroxy-2,4-dimethylbenzoate |
| InChIKey | UULOJLNDMUKVNI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C(=O)OC)O)C |
Computed by PubChem (NCBI)