CAS 508169-18-4 is the registry number for 7-Chloromethyloxy-carbonyloxy-6-(5-chloropyridin-2-yl)-6,7-dihydro-5H-pyrrolo(3,4-b)pyrazin-5-one. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
Chloromethyl [6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] carbonate (CAS 508169-18-4) is a chemical compound with the molecular formula C13H8Cl2N4O4 and a molecular weight of 355.13 g/mol. IUPAC name: chloromethyl [6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] carbonate. InChIKey: LTLOOQRIMYDJAP-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2N4O4 |
|---|---|
| Molecular weight | 355.13 g/mol |
| IUPAC name | chloromethyl [6-(5-chloro-2-pyridinyl)-5-oxo-7H-pyrrolo[3,4-b]pyrazin-7-yl] carbonate |
| InChIKey | LTLOOQRIMYDJAP-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1Cl)N2C(C3=NC=CN=C3C2=O)OC(=O)OCCl |
Computed by PubChem (NCBI)