CAS 508187-76-6 appears in our catalog under these names: N-Benzyl-1-((4-chlorophenyl)sulfonyl)piperidine-4-carboxamide, 98%, Antimalarial agent 17, ≥97%, ≥97%, Antimalarial agent 17, 99.51%. Offered by: Chemat Brand, Chemat, MedChemExpress. Available pack sizes: on request, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM/1mL, 5 mg.
N-benzyl-1-(4-chlorophenyl)sulfonylpiperidine-4-carboxamide (CAS 508187-76-6) is a chemical compound with the molecular formula C19H21ClN2O3S and a molecular weight of 392.9 g/mol. IUPAC name: N-benzyl-1-(4-chlorophenyl)sulfonylpiperidine-4-carboxamide. InChIKey: GIJGHINOALWYCL-UHFFFAOYSA-N.
| Molecular formula | C19H21ClN2O3S |
|---|---|
| Molecular weight | 392.9 g/mol |
| IUPAC name | N-benzyl-1-(4-chlorophenyl)sulfonylpiperidine-4-carboxamide |
| InChIKey | GIJGHINOALWYCL-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)NCC2=CC=CC=C2)S(=O)(=O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)