CAS 508233-77-0 appears in our catalog under these names: Vortioxetine Impurity 8, Vortioxetine Impurity C, Vortioxetine Impurity 15, 1-{2-[(2,5-dimethylphenyl)sulfanyl]phenyl}piperazine, 95%, 95%, 1-(2-((2,5-Dimethylphenyl)thio)phenyl)piperazine, 95%. Offered by: Chemat Brand, Hubei YoungXin, Chemat. Available pack sizes: on request, 100mg, 10mg, 200mg, 25mg, 50mg, 250mg.
1-[2-(2,5-dimethylphenyl)sulfanylphenyl]piperazine (CAS 508233-77-0) is a chemical compound with the molecular formula C18H22N2S and a molecular weight of 298.4 g/mol. IUPAC name: 1-[2-(2,5-dimethylphenyl)sulfanylphenyl]piperazine. InChIKey: OLSUXQFACZYSFC-UHFFFAOYSA-N.
| Molecular formula | C18H22N2S |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | 1-[2-(2,5-dimethylphenyl)sulfanylphenyl]piperazine |
| InChIKey | OLSUXQFACZYSFC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)SC2=CC=CC=C2N3CCNCC3 |
Computed by PubChem (NCBI)