Products 50838-36-3
CAS 50838-36-3 is the registry number for Tolciclate. Offered by: MedChemExpress. Available pack sizes: Get quote.
O-[[(1R,8S)-4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl]] N-methyl-N-(3-methylphenyl)carbamothioate (CAS 50838-36-3) is a chemical compound with the molecular formula C20H21NOS and a molecular weight of 323.5 g/mol. IUPAC name: O-[[(1R,8S)-4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl]] N-methyl-N-(3-methylphenyl)carbamothioate. InChIKey: CANCCLAKQQHLNK-LSDHHAIUSA-N.
| Molecular formula | C20H21NOS |
|---|---|
| Molecular weight | 323.5 g/mol |
| IUPAC name | O-[[(1R,8S)-4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl]] N-methyl-N-(3-methylphenyl)carbamothioate |
| InChIKey | CANCCLAKQQHLNK-LSDHHAIUSA-N |
| SMILES | CC1=CC(=CC=C1)N(C)C(=S)OC2=CC3=C(C=C2)[C@H]4CC[C@@H]3C4 |
Computed by PubChem (NCBI)