CAS 50848-29-8 is the registry number for 5-(2,4-Dichlorophenoxymethyl)-1,3,4-oxadiazole-2-thiol. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
5-[(2,4-dichlorophenoxy)methyl]-3H-1,3,4-oxadiazole-2-thione (CAS 50848-29-8) is a chemical compound with the molecular formula C9H6Cl2N2O2S and a molecular weight of 277.13 g/mol. IUPAC name: 5-[(2,4-dichlorophenoxy)methyl]-3H-1,3,4-oxadiazole-2-thione. InChIKey: SUHJVNSZUGQVLF-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2O2S |
|---|---|
| Molecular weight | 277.13 g/mol |
| IUPAC name | 5-[(2,4-dichlorophenoxy)methyl]-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | SUHJVNSZUGQVLF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)OCC2=NNC(=S)O2 |
Computed by PubChem (NCBI)