Products 5085-65-4
CAS 5085-65-4 appears in our catalog under these names: N6-Methyl-dATP, N6–Methyl–dATP. Offered by: MedChemExpress, GLPBio. Available pack sizes: Get quote, 10ul (100mM), 100ul (100mM), 50ul (100mM).
[hydroxy-[[(2S,4R,5R)-4-hydroxy-5-[6-(methylamino)purin-9-yl]oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate (CAS 5085-65-4) is a chemical compound with the molecular formula C11H18N5O12P3 and a molecular weight of 505.21 g/mol. IUPAC name: [hydroxy-[[(2S,4R,5R)-4-hydroxy-5-[6-(methylamino)purin-9-yl]oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate. InChIKey: ATIKTICAJNFDJT-MVKOHCKWSA-N.
| Molecular formula | C11H18N5O12P3 |
|---|---|
| Molecular weight | 505.21 g/mol |
| IUPAC name | [hydroxy-[[(2S,4R,5R)-4-hydroxy-5-[6-(methylamino)purin-9-yl]oxolan-2-yl]methoxy]phosphoryl] phosphono hydrogen phosphate |
| InChIKey | ATIKTICAJNFDJT-MVKOHCKWSA-N |
| SMILES | CNC1=C2C(=NC=N1)N(C=N2)[C@H]3[C@@H](C[C@H](O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O |
Computed by PubChem (NCBI)