CAS 509-72-8 appears in our catalog under these names: 3',6'-Diamino-3H-spiro[isobenzofuran-1,9'-xanthen]-3-one 97%, 3′,6′-Diaminospiro[isobenzofuran-1(3H),9′-[9H]xanthen]-3-one, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg.
3',6'-diaminospiro[2-benzofuran-3,9'-xanthene]-1-one (CAS 509-72-8) is a chemical compound with the molecular formula C20H14N2O3 and a molecular weight of 330.3 g/mol. IUPAC name: 3',6'-diaminospiro[2-benzofuran-3,9'-xanthene]-1-one. InChIKey: ACNUVXZPCIABEX-UHFFFAOYSA-N.
| Molecular formula | C20H14N2O3 |
|---|---|
| Molecular weight | 330.3 g/mol |
| IUPAC name | 3',6'-diaminospiro[2-benzofuran-3,9'-xanthene]-1-one |
| InChIKey | ACNUVXZPCIABEX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)OC23C4=C(C=C(C=C4)N)OC5=C3C=CC(=C5)N |
Computed by PubChem (NCBI)