CAS 50903-09-8 is the registry number for 1,3-Dichloro-5-methoxy-2,4-dinitrobenzene, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
1,3-dichloro-5-methoxy-2,4-dinitrobenzene (CAS 50903-09-8) is a chemical compound with the molecular formula C7H4Cl2N2O5 and a molecular weight of 267.02 g/mol. IUPAC name: 1,3-dichloro-5-methoxy-2,4-dinitrobenzene. InChIKey: AMLGLVXMLOTYBB-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2N2O5 |
|---|---|
| Molecular weight | 267.02 g/mol |
| IUPAC name | 1,3-dichloro-5-methoxy-2,4-dinitrobenzene |
| InChIKey | AMLGLVXMLOTYBB-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1[N+](=O)[O-])Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)